C40H45N4O4+ — CID 20625157
4-(1,3-dioxoisoindol-2-yl)butyl-dimethyl-[[2-[[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]methyl]phenyl]methyl]azanium (PubChem CID 20625157) has the molecular formula C40H45N4O4+ and a molecular weight of 645.82 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butyl-dimethyl-[[2-[[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]methyl]phenyl]methyl]azanium.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butyl-dimethyl-[[2-[[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]methyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 20625157 |
| Molecular Formula | C40H45N4O4+ |
| Molecular Weight | 645.82 g/mol |
| Exact Mass | 645.34 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butyl-dimethyl-[[2-[[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]methyl]phenyl]methyl]azanium |
| SMILES | C[N+](C)(CCCCN1C(=O)c2ccccc2C1=O)Cc1ccccc1CN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C40H44N4O4/c1-44(2,27-13-12-24-43-38(45)35-19-8-9-20-36(35)39(43)46)29-32-17-7-6-16-31(32)28-42-25-22-33(23-26-42)48-40(47)41-37-21-11-10-18-34(37)30-14-4-3-5-15-30/h3-11,14-21,33H,12-13,22-29H2,1-2H3/p+1 |
| InChIKey | XBNIZQHWVYQGKR-UHFFFAOYSA-O |
| XLogP | 7.22 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.82 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|