C36H56N3O2+ — CID 20625286
cyclohexylmethyl-dimethyl-[9-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]nonyl]azanium (PubChem CID 20625286) has the molecular formula C36H56N3O2+ and a molecular weight of 562.86 g/mol. Its IUPAC name is cyclohexylmethyl-dimethyl-[9-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]nonyl]azanium.
| Compound Name | cyclohexylmethyl-dimethyl-[9-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]nonyl]azanium |
|---|---|
| PubChem CID | 20625286 |
| Molecular Formula | C36H56N3O2+ |
| Molecular Weight | 562.86 g/mol |
| Exact Mass | 562.44 |
| IUPAC Name | cyclohexylmethyl-dimethyl-[9-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]nonyl]azanium |
| SMILES | C[N+](C)(CCCCCCCCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)CC1CCCCC1 |
| InChI | InChI=1S/C36H55N3O2/c1-39(2,30-31-18-10-8-11-19-31)29-17-7-5-3-4-6-16-26-38-27-24-33(25-28-38)41-36(40)37-35-23-15-14-22-34(35)32-20-12-9-13-21-32/h9,12-15,20-23,31,33H,3-8,10-11,16-19,24-30H2,1-2H3/p+1 |
| InChIKey | VRGCMQLAEVVEBP-UHFFFAOYSA-O |
| XLogP | 8.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.86 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|