C28H41N3O2 — CID 20624927
[1-[7-[ethyl(methyl)amino]heptyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 20624927) has the molecular formula C28H41N3O2 and a molecular weight of 451.66 g/mol. Its IUPAC name is [1-[7-[ethyl(methyl)amino]heptyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[7-[ethyl(methyl)amino]heptyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 20624927 |
| Molecular Formula | C28H41N3O2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.32 |
| IUPAC Name | [1-[7-[ethyl(methyl)amino]heptyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CCN(C)CCCCCCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C28H41N3O2/c1-3-30(2)20-12-5-4-6-13-21-31-22-18-25(19-23-31)33-28(32)29-27-17-11-10-16-26(27)24-14-8-7-9-15-24/h7-11,14-17,25H,3-6,12-13,18-23H2,1-2H3,(H,29,32) |
| InChIKey | ZBCBBKCDCVHAJZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|