C39H52N4O4 — CID 70947271
[1-[10-[methyl-[2-(4-oxo-2H-1,3-benzoxazin-3-yl)ethyl]amino]decyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 70947271) has the molecular formula C39H52N4O4 and a molecular weight of 640.87 g/mol. Its IUPAC name is [1-[10-[methyl-[2-(4-oxo-2H-1,3-benzoxazin-3-yl)ethyl]amino]decyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[10-[methyl-[2-(4-oxo-2H-1,3-benzoxazin-3-yl)ethyl]amino]decyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 70947271 |
| Molecular Formula | C39H52N4O4 |
| Molecular Weight | 640.87 g/mol |
| Exact Mass | 640.40 |
| IUPAC Name | [1-[10-[methyl-[2-(4-oxo-2H-1,3-benzoxazin-3-yl)ethyl]amino]decyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CN(CCCCCCCCCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)CCN1COc2ccccc2C1=O |
| InChI | InChI=1S/C39H52N4O4/c1-41(29-30-43-31-46-37-22-14-12-20-35(37)38(43)44)25-15-6-4-2-3-5-7-16-26-42-27-23-33(24-28-42)47-39(45)40-36-21-13-11-19-34(36)32-17-9-8-10-18-32/h8-14,17-22,33H,2-7,15-16,23-31H2,1H3,(H,40,45) |
| InChIKey | IXGFVALJUBYCCW-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.87 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|