C35H45Cl2N3O3 — CID 44610652
[1-[9-[(3,5-dichloro-4-hydroxyphenyl)methyl-methylamino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 44610652) has the molecular formula C35H45Cl2N3O3 and a molecular weight of 626.67 g/mol. Its IUPAC name is [1-[9-[(3,5-dichloro-4-hydroxyphenyl)methyl-methylamino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[9-[(3,5-dichloro-4-hydroxyphenyl)methyl-methylamino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 44610652 |
| Molecular Formula | C35H45Cl2N3O3 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | [1-[9-[(3,5-dichloro-4-hydroxyphenyl)methyl-methylamino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CN(CCCCCCCCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)Cc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C35H45Cl2N3O3/c1-39(26-27-24-31(36)34(41)32(37)25-27)20-12-5-3-2-4-6-13-21-40-22-18-29(19-23-40)43-35(42)38-33-17-11-10-16-30(33)28-14-8-7-9-15-28/h7-11,14-17,24-25,29,41H,2-6,12-13,18-23,26H2,1H3,(H,38,42) |
| InChIKey | GLUBUVGNLVKMGK-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|