C34H43Cl2N3O3 — CID 44610609
[1-[9-[(3,5-dichloro-4-hydroxyphenyl)methylamino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 44610609) has the molecular formula C34H43Cl2N3O3 and a molecular weight of 612.64 g/mol. Its IUPAC name is [1-[9-[(3,5-dichloro-4-hydroxyphenyl)methylamino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[9-[(3,5-dichloro-4-hydroxyphenyl)methylamino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 44610609 |
| Molecular Formula | C34H43Cl2N3O3 |
| Molecular Weight | 612.64 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | [1-[9-[(3,5-dichloro-4-hydroxyphenyl)methylamino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)OC1CCN(CCCCCCCCCNCc2cc(Cl)c(O)c(Cl)c2)CC1 |
| InChI | InChI=1S/C34H43Cl2N3O3/c35-30-23-26(24-31(36)33(30)40)25-37-19-11-4-2-1-3-5-12-20-39-21-17-28(18-22-39)42-34(41)38-32-16-10-9-15-29(32)27-13-7-6-8-14-27/h6-10,13-16,23-24,28,37,40H,1-5,11-12,17-22,25H2,(H,38,41) |
| InChIKey | SHHYQLDVWPNUHY-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.64 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|