C35H44ClN3O4 — CID 44595573
[1-[9-[[2-(3-chloro-4-hydroxyphenyl)acetyl]amino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 44595573) has the molecular formula C35H44ClN3O4 and a molecular weight of 606.21 g/mol. Its IUPAC name is [1-[9-[[2-(3-chloro-4-hydroxyphenyl)acetyl]amino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[9-[[2-(3-chloro-4-hydroxyphenyl)acetyl]amino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 44595573 |
| Molecular Formula | C35H44ClN3O4 |
| Molecular Weight | 606.21 g/mol |
| Exact Mass | 605.30 |
| IUPAC Name | [1-[9-[[2-(3-chloro-4-hydroxyphenyl)acetyl]amino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | O=C(Cc1ccc(O)c(Cl)c1)NCCCCCCCCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C35H44ClN3O4/c36-31-25-27(17-18-33(31)40)26-34(41)37-21-11-4-2-1-3-5-12-22-39-23-19-29(20-24-39)43-35(42)38-32-16-10-9-15-30(32)28-13-7-6-8-14-28/h6-10,13-18,25,29,40H,1-5,11-12,19-24,26H2,(H,37,41)(H,38,42) |
| InChIKey | YNRGXMSCKJTMBJ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.21 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|