C34H37N3O2 — CID 20624858
[1-[2-[benzhydryl(methyl)amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 20624858) has the molecular formula C34H37N3O2 and a molecular weight of 519.69 g/mol. Its IUPAC name is [1-[2-[benzhydryl(methyl)amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[benzhydryl(methyl)amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 20624858 |
| Molecular Formula | C34H37N3O2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | [1-[2-[benzhydryl(methyl)amino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CN(CCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H37N3O2/c1-36(33(28-15-7-3-8-16-28)29-17-9-4-10-18-29)25-26-37-23-21-30(22-24-37)39-34(38)35-32-20-12-11-19-31(32)27-13-5-2-6-14-27/h2-20,30,33H,21-26H2,1H3,(H,35,38) |
| InChIKey | UIFIGZBFHKZLMQ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |