C35H50N3O4+ — CID 20625194
[5-(hydroxymethyl)furan-2-yl]methyl-dimethyl-[9-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]nonyl]azanium (PubChem CID 20625194) has the molecular formula C35H50N3O4+ and a molecular weight of 576.80 g/mol. Its IUPAC name is [5-(hydroxymethyl)furan-2-yl]methyl-dimethyl-[9-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]nonyl]azanium.
| Compound Name | [5-(hydroxymethyl)furan-2-yl]methyl-dimethyl-[9-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]nonyl]azanium |
|---|---|
| PubChem CID | 20625194 |
| Molecular Formula | C35H50N3O4+ |
| Molecular Weight | 576.80 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | [5-(hydroxymethyl)furan-2-yl]methyl-dimethyl-[9-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]nonyl]azanium |
| SMILES | C[N+](C)(CCCCCCCCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)Cc1ccc(CO)o1 |
| InChI | InChI=1S/C35H49N3O4/c1-38(2,27-31-19-20-32(28-39)41-31)26-14-7-5-3-4-6-13-23-37-24-21-30(22-25-37)42-35(40)36-34-18-12-11-17-33(34)29-15-9-8-10-16-29/h8-12,15-20,30,39H,3-7,13-14,21-28H2,1-2H3/p+1 |
| InChIKey | URJIAWBYAHOGCW-UHFFFAOYSA-O |
| XLogP | 7.46 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.80 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|