C35H56N3O4+ — CID 20625084
2,2-diethoxyethyl-dimethyl-[9-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]nonyl]azanium (PubChem CID 20625084) has the molecular formula C35H56N3O4+ and a molecular weight of 582.85 g/mol. Its IUPAC name is 2,2-diethoxyethyl-dimethyl-[9-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]nonyl]azanium.
| Compound Name | 2,2-diethoxyethyl-dimethyl-[9-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]nonyl]azanium |
|---|---|
| PubChem CID | 20625084 |
| Molecular Formula | C35H56N3O4+ |
| Molecular Weight | 582.85 g/mol |
| Exact Mass | 582.43 |
| IUPAC Name | 2,2-diethoxyethyl-dimethyl-[9-[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]nonyl]azanium |
| SMILES | CCOC(C[N+](C)(C)CCCCCCCCCN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1)OCC |
| InChI | InChI=1S/C35H55N3O4/c1-5-40-34(41-6-2)29-38(3,4)28-18-11-9-7-8-10-17-25-37-26-23-31(24-27-37)42-35(39)36-33-22-16-15-21-32(33)30-19-13-12-14-20-30/h12-16,19-22,31,34H,5-11,17-18,23-29H2,1-4H3/p+1 |
| InChIKey | KZGFJRQICANJOR-UHFFFAOYSA-O |
| XLogP | 7.57 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.85 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|