C30H38N3O2+ — CID 20625302
ethyl-dimethyl-[[4-[[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]methyl]phenyl]methyl]azanium (PubChem CID 20625302) has the molecular formula C30H38N3O2+ and a molecular weight of 472.65 g/mol. Its IUPAC name is ethyl-dimethyl-[[4-[[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]methyl]phenyl]methyl]azanium.
| Compound Name | ethyl-dimethyl-[[4-[[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]methyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 20625302 |
| Molecular Formula | C30H38N3O2+ |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | ethyl-dimethyl-[[4-[[4-[(2-phenylphenyl)carbamoyloxy]piperidin-1-yl]methyl]phenyl]methyl]azanium |
| SMILES | CC[N+](C)(C)Cc1ccc(CN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H37N3O2/c1-4-33(2,3)23-25-16-14-24(15-17-25)22-32-20-18-27(19-21-32)35-30(34)31-29-13-9-8-12-28(29)26-10-6-5-7-11-26/h5-17,27H,4,18-23H2,1-3H3/p+1 |
| InChIKey | ARIWYCOYGKVMIY-UHFFFAOYSA-O |
| XLogP | 6.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|