C18H21N2O2P — CID 143572443
(1-phosphanylpiperidin-4-yl) N-(2-phenylphenyl)carbamate (PubChem CID 143572443) has the molecular formula C18H21N2O2P and a molecular weight of 328.35 g/mol. Its IUPAC name is (1-phosphanylpiperidin-4-yl) N-(2-phenylphenyl)carbamate.
| Compound Name | (1-phosphanylpiperidin-4-yl) N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 143572443 |
| Molecular Formula | C18H21N2O2P |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (1-phosphanylpiperidin-4-yl) N-(2-phenylphenyl)carbamate |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)OC1CCN(P)CC1 |
| InChI | InChI=1S/C18H21N2O2P/c21-18(22-15-10-12-20(23)13-11-15)19-17-9-5-4-8-16(17)14-6-2-1-3-7-14/h1-9,15H,10-13,23H2,(H,19,21) |
| InChIKey | IJPSPRYLVXQHCC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|