C38H44N4O4 — CID 162021431
1-isocyanato-2-phenylbenzene;1-methylpiperidin-4-ol;(1-methylpiperidin-4-yl) N-(2-phenylphenyl)carbamate (PubChem CID 162021431) has the molecular formula C38H44N4O4 and a molecular weight of 620.79 g/mol. Its IUPAC name is 1-isocyanato-2-phenylbenzene;1-methylpiperidin-4-ol;(1-methylpiperidin-4-yl) N-(2-phenylphenyl)carbamate.
| Compound Name | 1-isocyanato-2-phenylbenzene;1-methylpiperidin-4-ol;(1-methylpiperidin-4-yl) N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 162021431 |
| Molecular Formula | C38H44N4O4 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.34 |
| IUPAC Name | 1-isocyanato-2-phenylbenzene;1-methylpiperidin-4-ol;(1-methylpiperidin-4-yl) N-(2-phenylphenyl)carbamate |
| SMILES | CN1CCC(O)CC1.CN1CCC(OC(=O)Nc2ccccc2-c2ccccc2)CC1.O=C=Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C19H22N2O2.C13H9NO.C6H13NO/c1-21-13-11-16(12-14-21)23-19(22)20-18-10-6-5-9-17(18)15-7-3-2-4-8-15;15-10-14-13-9-5-4-8-12(13)11-6-2-1-3-7-11;1-7-4-2-6(8)3-5-7/h2-10,16H,11-14H2,1H3,(H,20,22);1-9H;6,8H,2-5H2,1H3 |
| InChIKey | YUUKWLBBFUFFOO-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|