C18H23N5O2 — CID 18174473
methyl N-(2,3-diaminophenyl)-N-(1-pyridin-4-ylpiperidin-4-yl)carbamate (PubChem CID 18174473) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is methyl N-(2,3-diaminophenyl)-N-(1-pyridin-4-ylpiperidin-4-yl)carbamate.
| Compound Name | methyl N-(2,3-diaminophenyl)-N-(1-pyridin-4-ylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 18174473 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | methyl N-(2,3-diaminophenyl)-N-(1-pyridin-4-ylpiperidin-4-yl)carbamate |
| SMILES | COC(=O)N(c1cccc(N)c1N)C1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C18H23N5O2/c1-25-18(24)23(16-4-2-3-15(19)17(16)20)14-7-11-22(12-8-14)13-5-9-21-10-6-13/h2-6,9-10,14H,7-8,11-12,19-20H2,1H3 |
| InChIKey | KBDJOJNEOODSAD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|