C26H29N5O3 — CID 69361854
methyl N-[2-amino-6-(4-methylbenzoyl)anilino]-N-(1-pyridin-4-ylpiperidin-4-yl)carbamate (PubChem CID 69361854) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is methyl N-[2-amino-6-(4-methylbenzoyl)anilino]-N-(1-pyridin-4-ylpiperidin-4-yl)carbamate.
| Compound Name | methyl N-[2-amino-6-(4-methylbenzoyl)anilino]-N-(1-pyridin-4-ylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 69361854 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | methyl N-[2-amino-6-(4-methylbenzoyl)anilino]-N-(1-pyridin-4-ylpiperidin-4-yl)carbamate |
| SMILES | COC(=O)N(Nc1c(N)cccc1C(=O)c1ccc(C)cc1)C1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C26H29N5O3/c1-18-6-8-19(9-7-18)25(32)22-4-3-5-23(27)24(22)29-31(26(33)34-2)21-12-16-30(17-13-21)20-10-14-28-15-11-20/h3-11,14-15,21,29H,12-13,16-17,27H2,1-2H3 |
| InChIKey | CLDOUHGXWXOBJK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|