C26H28N4O3 — CID 118968713
methyl 4-[(4-methyl-N-(4-pyridin-4-ylpiperazine-1-carbonyl)anilino)methyl]benzoate (PubChem CID 118968713) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is methyl 4-[(4-methyl-N-(4-pyridin-4-ylpiperazine-1-carbonyl)anilino)methyl]benzoate.
| Compound Name | methyl 4-[(4-methyl-N-(4-pyridin-4-ylpiperazine-1-carbonyl)anilino)methyl]benzoate |
|---|---|
| PubChem CID | 118968713 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | methyl 4-[(4-methyl-N-(4-pyridin-4-ylpiperazine-1-carbonyl)anilino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCN(c3ccncc3)CC2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H28N4O3/c1-20-3-9-24(10-4-20)30(19-21-5-7-22(8-6-21)25(31)33-2)26(32)29-17-15-28(16-18-29)23-11-13-27-14-12-23/h3-14H,15-19H2,1-2H3 |
| InChIKey | KPMWVHKFACWXCG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |