C26H27N3O3 — CID 158775998
methyl 4-[[N-(piperidine-1-carbonyl)-3-pyridin-3-ylanilino]methyl]benzoate (PubChem CID 158775998) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is methyl 4-[[N-(piperidine-1-carbonyl)-3-pyridin-3-ylanilino]methyl]benzoate.
| Compound Name | methyl 4-[[N-(piperidine-1-carbonyl)-3-pyridin-3-ylanilino]methyl]benzoate |
|---|---|
| PubChem CID | 158775998 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | methyl 4-[[N-(piperidine-1-carbonyl)-3-pyridin-3-ylanilino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCCCC2)c2cccc(-c3cccnc3)c2)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-32-25(30)21-12-10-20(11-13-21)19-29(26(31)28-15-3-2-4-16-28)24-9-5-7-22(17-24)23-8-6-14-27-18-23/h5-14,17-18H,2-4,15-16,19H2,1H3 |
| InChIKey | MCQXDQHGTDGQRM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |