C29H30N4O3 — CID 158523107
methyl 4-[[3-(1-methylindazol-6-yl)-N-(piperidine-1-carbonyl)anilino]methyl]benzoate (PubChem CID 158523107) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is methyl 4-[[3-(1-methylindazol-6-yl)-N-(piperidine-1-carbonyl)anilino]methyl]benzoate.
| Compound Name | methyl 4-[[3-(1-methylindazol-6-yl)-N-(piperidine-1-carbonyl)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 158523107 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | methyl 4-[[3-(1-methylindazol-6-yl)-N-(piperidine-1-carbonyl)anilino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCCCC2)c2cccc(-c3ccc4cnn(C)c4c3)c2)cc1 |
| InChI | InChI=1S/C29H30N4O3/c1-31-27-18-24(13-14-25(27)19-30-31)23-7-6-8-26(17-23)33(29(35)32-15-4-3-5-16-32)20-21-9-11-22(12-10-21)28(34)36-2/h6-14,17-19H,3-5,15-16,20H2,1-2H3 |
| InChIKey | XQIVCRZLPCFALN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |