C21H22F2N2O3 — CID 134584224
methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate (PubChem CID 134584224) has the molecular formula C21H22F2N2O3 and a molecular weight of 388.41 g/mol. Its IUPAC name is methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate.
| Compound Name | methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate |
|---|---|
| PubChem CID | 134584224 |
| Molecular Formula | C21H22F2N2O3 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCC(F)(F)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22F2N2O3/c1-28-19(26)17-9-7-16(8-10-17)15-25(18-5-3-2-4-6-18)20(27)24-13-11-21(22,23)12-14-24/h2-10H,11-15H2,1H3 |
| InChIKey | BODMCHGJLBYVDW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |