About methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate
methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate (PubChem CID 134584224) has the molecular formula C21H22F2N2O3
and a molecular weight of 388.41 g/mol. Its IUPAC name is methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate |
| PubChem CID | 134584224 |
| Molecular Formula | C21H22F2N2O3 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCC(F)(F)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22F2N2O3/c1-28-19(26)17-9-7-16(8-10-17)15-25(18-5-3-2-4-6-18)20(27)24-13-11-21(22,23)12-14-24/h2-10H,11-15H2,1H3 |
| InChIKey | BODMCHGJLBYVDW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate?
The IUPAC name of methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate (CID 134584224) is methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate.
What is the SMILES notation for methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate?
The canonical SMILES for methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate is COC(=O)c1ccc(CN(C(=O)N2CCC(F)(F)CC2)c2ccccc2)cc1.
What is the InChIKey of methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate?
The InChIKey is BODMCHGJLBYVDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22F2N2O3/c1-28-19(26)17-9-7-16(8-10-17)15-25(18-5-3-2-4-6-18)20(27)24-13-11-21(22,23)12-14-24/h2-10H,11-15H2,1H3.
What are the key properties of methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate?
methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate has a molecular weight of 388.41 g/mol, XLogP of 4.33, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(N-(4,4-difluoropiperidine-1-carbonyl)anilino)methyl]benzoate is sourced from PubChem (CID 134584224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).