C27H28N2O3 — CID 160695024
methyl 4-[[3-phenyl-N-(piperidine-1-carbonyl)anilino]methyl]benzoate (PubChem CID 160695024) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is methyl 4-[[3-phenyl-N-(piperidine-1-carbonyl)anilino]methyl]benzoate.
| Compound Name | methyl 4-[[3-phenyl-N-(piperidine-1-carbonyl)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 160695024 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | methyl 4-[[3-phenyl-N-(piperidine-1-carbonyl)anilino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCCCC2)c2cccc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H28N2O3/c1-32-26(30)23-15-13-21(14-16-23)20-29(27(31)28-17-6-3-7-18-28)25-12-8-11-24(19-25)22-9-4-2-5-10-22/h2,4-5,8-16,19H,3,6-7,17-18,20H2,1H3 |
| InChIKey | SLJLBFVEFWNMNI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |