C24H24N2O4S — CID 175166485
methyl 4-[[3-(furan-3-yl)-N-(thiomorpholine-4-carbonyl)anilino]methyl]benzoate (PubChem CID 175166485) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is methyl 4-[[3-(furan-3-yl)-N-(thiomorpholine-4-carbonyl)anilino]methyl]benzoate.
| Compound Name | methyl 4-[[3-(furan-3-yl)-N-(thiomorpholine-4-carbonyl)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 175166485 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | methyl 4-[[3-(furan-3-yl)-N-(thiomorpholine-4-carbonyl)anilino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCSCC2)c2cccc(-c3ccoc3)c2)cc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-29-23(27)19-7-5-18(6-8-19)16-26(24(28)25-10-13-31-14-11-25)22-4-2-3-20(15-22)21-9-12-30-17-21/h2-9,12,15,17H,10-11,13-14,16H2,1H3 |
| InChIKey | SYZBKZGCTWTKJV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |