C21H23FN2O4 — CID 163940319
methyl 4-[[4-fluoro-3-methyl-N-(morpholine-4-carbonyl)anilino]methyl]benzoate (PubChem CID 163940319) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is methyl 4-[[4-fluoro-3-methyl-N-(morpholine-4-carbonyl)anilino]methyl]benzoate.
| Compound Name | methyl 4-[[4-fluoro-3-methyl-N-(morpholine-4-carbonyl)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 163940319 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | methyl 4-[[4-fluoro-3-methyl-N-(morpholine-4-carbonyl)anilino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCOCC2)c2ccc(F)c(C)c2)cc1 |
| InChI | InChI=1S/C21H23FN2O4/c1-15-13-18(7-8-19(15)22)24(21(26)23-9-11-28-12-10-23)14-16-3-5-17(6-4-16)20(25)27-2/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | RQKUGXXPHKSEHR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |