C42H38F2N4O10 — CID 175784592
methyl 4-[[3-fluoro-N-(morpholine-4-carbonyl)anilino]methyl]benzoate;methyl 4-[(3-fluoro-N-(4-nitrophenoxy)carbonylanilino)methyl]benzoate (PubChem CID 175784592) has the molecular formula C42H38F2N4O10 and a molecular weight of 796.78 g/mol. Its IUPAC name is methyl 4-[[3-fluoro-N-(morpholine-4-carbonyl)anilino]methyl]benzoate;methyl 4-[(3-fluoro-N-(4-nitrophenoxy)carbonylanilino)methyl]benzoate.
| Compound Name | methyl 4-[[3-fluoro-N-(morpholine-4-carbonyl)anilino]methyl]benzoate;methyl 4-[(3-fluoro-N-(4-nitrophenoxy)carbonylanilino)methyl]benzoate |
|---|---|
| PubChem CID | 175784592 |
| Molecular Formula | C42H38F2N4O10 |
| Molecular Weight | 796.78 g/mol |
| Exact Mass | 796.26 |
| IUPAC Name | methyl 4-[[3-fluoro-N-(morpholine-4-carbonyl)anilino]methyl]benzoate;methyl 4-[(3-fluoro-N-(4-nitrophenoxy)carbonylanilino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCOCC2)c2cccc(F)c2)cc1.COC(=O)c1ccc(CN(C(=O)Oc2ccc([N+](=O)[O-])cc2)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C22H17FN2O6.C20H21FN2O4/c1-30-21(26)16-7-5-15(6-8-16)14-24(19-4-2-3-17(23)13-19)22(27)31-20-11-9-18(10-12-20)25(28)29;1-26-19(24)16-7-5-15(6-8-16)14-23(18-4-2-3-17(21)13-18)20(25)22-9-11-27-12-10-22/h2-13H,14H2,1H3;2-8,13H,9-12,14H2,1H3 |
| InChIKey | HIASUTMSHMXVCG-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 158.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.78 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|