C39H37N3O10 — CID 175784648
methyl 4-[(3-methoxyanilino)methyl]benzoate;methyl 4-[(3-methoxy-N-(4-nitrophenoxy)carbonylanilino)methyl]benzoate (PubChem CID 175784648) has the molecular formula C39H37N3O10 and a molecular weight of 707.74 g/mol. Its IUPAC name is methyl 4-[(3-methoxyanilino)methyl]benzoate;methyl 4-[(3-methoxy-N-(4-nitrophenoxy)carbonylanilino)methyl]benzoate.
| Compound Name | methyl 4-[(3-methoxyanilino)methyl]benzoate;methyl 4-[(3-methoxy-N-(4-nitrophenoxy)carbonylanilino)methyl]benzoate |
|---|---|
| PubChem CID | 175784648 |
| Molecular Formula | C39H37N3O10 |
| Molecular Weight | 707.74 g/mol |
| Exact Mass | 707.25 |
| IUPAC Name | methyl 4-[(3-methoxyanilino)methyl]benzoate;methyl 4-[(3-methoxy-N-(4-nitrophenoxy)carbonylanilino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)Oc2ccc([N+](=O)[O-])cc2)c2cccc(OC)c2)cc1.COC(=O)c1ccc(CNc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C23H20N2O7.C16H17NO3/c1-30-21-5-3-4-19(14-21)24(15-16-6-8-17(9-7-16)22(26)31-2)23(27)32-20-12-10-18(11-13-20)25(28)29;1-19-15-5-3-4-14(10-15)17-11-12-6-8-13(9-7-12)16(18)20-2/h3-14H,15H2,1-2H3;3-10,17H,11H2,1-2H3 |
| InChIKey | NHEQOGOJDGTXFZ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 155.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.74 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|