C39H39Cl2F2N5O8 — CID 175784597
N-(3-chloro-4-fluorophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]morpholine-4-carboxamide;methyl 4-[[3-chloro-4-fluoro-N-(morpholine-4-carbonyl)anilino]methyl]benzoate (PubChem CID 175784597) has the molecular formula C39H39Cl2F2N5O8 and a molecular weight of 814.67 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]morpholine-4-carboxamide;methyl 4-[[3-chloro-4-fluoro-N-(morpholine-4-carbonyl)anilino]methyl]benzoate.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]morpholine-4-carboxamide;methyl 4-[[3-chloro-4-fluoro-N-(morpholine-4-carbonyl)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 175784597 |
| Molecular Formula | C39H39Cl2F2N5O8 |
| Molecular Weight | 814.67 g/mol |
| Exact Mass | 813.21 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]morpholine-4-carboxamide;methyl 4-[[3-chloro-4-fluoro-N-(morpholine-4-carbonyl)anilino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCOCC2)c2ccc(F)c(Cl)c2)cc1.O=C(NO)c1ccc(CN(C(=O)N2CCOCC2)c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H20ClFN2O4.C19H19ClFN3O4/c1-27-19(25)15-4-2-14(3-5-15)13-24(16-6-7-18(22)17(21)12-16)20(26)23-8-10-28-11-9-23;20-16-11-15(5-6-17(16)21)24(19(26)23-7-9-28-10-8-23)12-13-1-3-14(4-2-13)18(25)22-27/h2-7,12H,8-11,13H2,1H3;1-6,11,27H,7-10,12H2,(H,22,25) |
| InChIKey | KCHBKFUBTGGEDP-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.67 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|