C27H23F6N3O4 — CID 86280925
N-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-[[4-(hydroxycarbamoyl)phenyl]methyl]morpholine-4-carboxamide (PubChem CID 86280925) has the molecular formula C27H23F6N3O4 and a molecular weight of 567.49 g/mol. Its IUPAC name is N-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-[[4-(hydroxycarbamoyl)phenyl]methyl]morpholine-4-carboxamide.
| Compound Name | N-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-[[4-(hydroxycarbamoyl)phenyl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 86280925 |
| Molecular Formula | C27H23F6N3O4 |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | N-[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-N-[[4-(hydroxycarbamoyl)phenyl]methyl]morpholine-4-carboxamide |
| SMILES | O=C(NO)c1ccc(CN(C(=O)N2CCOCC2)c2ccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2)cc1 |
| InChI | InChI=1S/C27H23F6N3O4/c28-26(29,30)21-13-20(14-22(15-21)27(31,32)33)18-5-7-23(8-6-18)36(25(38)35-9-11-40-12-10-35)16-17-1-3-19(4-2-17)24(37)34-39/h1-8,13-15,39H,9-12,16H2,(H,34,37) |
| InChIKey | QTHFBKDJECTSAL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|