C20H19F3IN3O3 — CID 170096907
(3R)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-3-iodo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 170096907) has the molecular formula C20H19F3IN3O3 and a molecular weight of 533.29 g/mol. Its IUPAC name is (3R)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-3-iodo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-3-iodo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 170096907 |
| Molecular Formula | C20H19F3IN3O3 |
| Molecular Weight | 533.29 g/mol |
| Exact Mass | 533.04 |
| IUPAC Name | (3R)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]-3-iodo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NO)c1ccc(CN(C(=O)N2CC[C@@H](I)C2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H19F3IN3O3/c21-20(22,23)15-5-7-17(8-6-15)27(19(29)26-10-9-16(24)12-26)11-13-1-3-14(4-2-13)18(28)25-30/h1-8,16,30H,9-12H2,(H,25,28)/t16-/m1/s1 |
| InChIKey | LVYJYLYMFDCMRE-MRXNPFEDSA-N |
| XLogP | 4.46 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|