C28H27F3N2O3 — CID 134012078
N-benzyl-N-(4-methoxyphenyl)-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide (PubChem CID 134012078) has the molecular formula C28H27F3N2O3 and a molecular weight of 496.53 g/mol. Its IUPAC name is N-benzyl-N-(4-methoxyphenyl)-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-N-(4-methoxyphenyl)-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 134012078 |
| Molecular Formula | C28H27F3N2O3 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-benzyl-N-(4-methoxyphenyl)-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(N(Cc2ccccc2)C(=O)C2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H27F3N2O3/c1-36-25-13-11-24(12-14-25)33(19-20-5-3-2-4-6-20)27(35)22-15-17-32(18-16-22)26(34)21-7-9-23(10-8-21)28(29,30)31/h2-14,22H,15-19H2,1H3 |
| InChIKey | BWKOYXUCASXPMH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |