C23H25F3N4O4 — CID 55497462
N'-[2-(4-methoxyanilino)acetyl]-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carbohydrazide (PubChem CID 55497462) has the molecular formula C23H25F3N4O4 and a molecular weight of 478.47 g/mol. Its IUPAC name is N'-[2-(4-methoxyanilino)acetyl]-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carbohydrazide.
| Compound Name | N'-[2-(4-methoxyanilino)acetyl]-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 55497462 |
| Molecular Formula | C23H25F3N4O4 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | N'-[2-(4-methoxyanilino)acetyl]-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carbohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)C2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H25F3N4O4/c1-34-19-8-6-18(7-9-19)27-14-20(31)28-29-21(32)15-10-12-30(13-11-15)22(33)16-2-4-17(5-3-16)23(24,25)26/h2-9,15,27H,10-14H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | BPQHKXZAAXTNRQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|