C26H28N4O4 — CID 55430041
N'-[2-(4-methoxyanilino)acetyl]-1-(naphthalene-1-carbonyl)piperidine-4-carbohydrazide (PubChem CID 55430041) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is N'-[2-(4-methoxyanilino)acetyl]-1-(naphthalene-1-carbonyl)piperidine-4-carbohydrazide.
| Compound Name | N'-[2-(4-methoxyanilino)acetyl]-1-(naphthalene-1-carbonyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 55430041 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | N'-[2-(4-methoxyanilino)acetyl]-1-(naphthalene-1-carbonyl)piperidine-4-carbohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)C2CCN(C(=O)c3cccc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C26H28N4O4/c1-34-21-11-9-20(10-12-21)27-17-24(31)28-29-25(32)19-13-15-30(16-14-19)26(33)23-8-4-6-18-5-2-3-7-22(18)23/h2-12,19,27H,13-17H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | CXOOBJXCTRIVPG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|