C25H25NO3 — CID 55430074
(2,6-dimethylphenyl) 1-(naphthalene-1-carbonyl)piperidine-4-carboxylate (PubChem CID 55430074) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 1-(naphthalene-1-carbonyl)piperidine-4-carboxylate.
| Compound Name | (2,6-dimethylphenyl) 1-(naphthalene-1-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55430074 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (2,6-dimethylphenyl) 1-(naphthalene-1-carbonyl)piperidine-4-carboxylate |
| SMILES | Cc1cccc(C)c1OC(=O)C1CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C25H25NO3/c1-17-7-5-8-18(2)23(17)29-25(28)20-13-15-26(16-14-20)24(27)22-12-6-10-19-9-3-4-11-21(19)22/h3-12,20H,13-16H2,1-2H3 |
| InChIKey | UABYNPBEIQVEOP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|