C25H24N2O4 — CID 55430267
methyl 2-[[1-(naphthalene-1-carbonyl)piperidine-4-carbonyl]amino]benzoate (PubChem CID 55430267) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is methyl 2-[[1-(naphthalene-1-carbonyl)piperidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[1-(naphthalene-1-carbonyl)piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 55430267 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | methyl 2-[[1-(naphthalene-1-carbonyl)piperidine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C25H24N2O4/c1-31-25(30)21-10-4-5-12-22(21)26-23(28)18-13-15-27(16-14-18)24(29)20-11-6-8-17-7-2-3-9-19(17)20/h2-12,18H,13-16H2,1H3,(H,26,28) |
| InChIKey | CDWRNXGSKQSVCP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |