C23H20Cl2N2O2 — CID 25479669
N-(2,4-dichlorophenyl)-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide (PubChem CID 25479669) has the molecular formula C23H20Cl2N2O2 and a molecular weight of 427.33 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2,4-dichlorophenyl)-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25479669 |
| Molecular Formula | C23H20Cl2N2O2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-(2,4-dichlorophenyl)-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)C1CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C23H20Cl2N2O2/c24-17-8-9-21(20(25)14-17)26-22(28)16-10-12-27(13-11-16)23(29)19-7-3-5-15-4-1-2-6-18(15)19/h1-9,14,16H,10-13H2,(H,26,28) |
| InChIKey | AZNBPSAIJZYWLW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |