C24H23ClN2O2 — CID 27396099
N-[(4-chlorophenyl)methyl]-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide (PubChem CID 27396099) has the molecular formula C24H23ClN2O2 and a molecular weight of 406.91 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27396099 |
| Molecular Formula | C24H23ClN2O2 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C1CCN(C(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C24H23ClN2O2/c25-20-10-8-17(9-11-20)16-26-23(28)19-12-14-27(15-13-19)24(29)22-7-3-5-18-4-1-2-6-21(18)22/h1-11,19H,12-16H2,(H,26,28) |
| InChIKey | OHUJCWKPBHOLDH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |