C24H23FN2O4S — CID 55429991
N-(2-fluoro-5-methylsulfonylphenyl)-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide (PubChem CID 55429991) has the molecular formula C24H23FN2O4S and a molecular weight of 454.52 g/mol. Its IUPAC name is N-(2-fluoro-5-methylsulfonylphenyl)-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2-fluoro-5-methylsulfonylphenyl)-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55429991 |
| Molecular Formula | C24H23FN2O4S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N-(2-fluoro-5-methylsulfonylphenyl)-1-(naphthalene-1-carbonyl)piperidine-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(F)c(NC(=O)C2CCN(C(=O)c3cccc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C24H23FN2O4S/c1-32(30,31)18-9-10-21(25)22(15-18)26-23(28)17-11-13-27(14-12-17)24(29)20-8-4-6-16-5-2-3-7-19(16)20/h2-10,15,17H,11-14H2,1H3,(H,26,28) |
| InChIKey | SJQNFQWGNYPODU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |