C20H26N2O5 — CID 113007963
methyl 2-[[1-(oxane-4-carbonyl)piperidine-4-carbonyl]amino]benzoate (PubChem CID 113007963) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is methyl 2-[[1-(oxane-4-carbonyl)piperidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[1-(oxane-4-carbonyl)piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 113007963 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | methyl 2-[[1-(oxane-4-carbonyl)piperidine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1CCN(C(=O)C2CCOCC2)CC1 |
| InChI | InChI=1S/C20H26N2O5/c1-26-20(25)16-4-2-3-5-17(16)21-18(23)14-6-10-22(11-7-14)19(24)15-8-12-27-13-9-15/h2-5,14-15H,6-13H2,1H3,(H,21,23) |
| InChIKey | JJZZPNMWNGHHLH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |