C22H31F3N2O3 — CID 55663900
N-(2-methoxyethyl)-N-pentan-3-yl-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide (PubChem CID 55663900) has the molecular formula C22H31F3N2O3 and a molecular weight of 428.50 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-pentan-3-yl-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-N-pentan-3-yl-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55663900 |
| Molecular Formula | C22H31F3N2O3 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-(2-methoxyethyl)-N-pentan-3-yl-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide |
| SMILES | CCC(CC)N(CCOC)C(=O)C1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H31F3N2O3/c1-4-19(5-2)27(14-15-30-3)21(29)17-10-12-26(13-11-17)20(28)16-6-8-18(9-7-16)22(23,24)25/h6-9,17,19H,4-5,10-15H2,1-3H3 |
| InChIKey | UTYGKVCZUPYHHW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |