C22H25BN2O4 — CID 90350135
CID 90350135 (PubChem CID 90350135) has the molecular formula C22H25BN2O4 and a molecular weight of 392.26 g/mol.
| Compound Name | CID 90350135 |
|---|---|
| PubChem CID | 90350135 |
| Molecular Formula | C22H25BN2O4 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | — |
| SMILES | [B]CN(C(=O)C1CCN(C(=O)OCc2ccccc2)CC1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H25BN2O4/c1-28-20-9-7-19(8-10-20)25(16-23)21(26)18-11-13-24(14-12-18)22(27)29-15-17-5-3-2-4-6-17/h2-10,18H,11-16H2,1H3 |
| InChIKey | CQKBHJJUKKCLOO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|