C28H29N2O7S- — CID 70034535
4-[carboxy-[4-(4-methoxyphenyl)-N-sulfinatoanilino]methyl]-1-phenylmethoxycarbonylpiperidine (PubChem CID 70034535) has the molecular formula C28H29N2O7S- and a molecular weight of 537.61 g/mol. Its IUPAC name is 4-[carboxy-[4-(4-methoxyphenyl)-N-sulfinatoanilino]methyl]-1-phenylmethoxycarbonylpiperidine.
| Compound Name | 4-[carboxy-[4-(4-methoxyphenyl)-N-sulfinatoanilino]methyl]-1-phenylmethoxycarbonylpiperidine |
|---|---|
| PubChem CID | 70034535 |
| Molecular Formula | C28H29N2O7S- |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 4-[carboxy-[4-(4-methoxyphenyl)-N-sulfinatoanilino]methyl]-1-phenylmethoxycarbonylpiperidine |
| SMILES | COc1ccc(-c2ccc(N(C(C(=O)O)C3CCN(C(=O)OCc4ccccc4)CC3)S(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C28H30N2O7S/c1-36-25-13-9-22(10-14-25)21-7-11-24(12-8-21)30(38(34)35)26(27(31)32)23-15-17-29(18-16-23)28(33)37-19-20-5-3-2-4-6-20/h2-14,23,26H,15-19H2,1H3,(H,31,32)(H,34,35)/p-1 |
| InChIKey | YHCWRKMLLGXYHL-UHFFFAOYSA-M |
| XLogP | 4.46 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|