C25H26F8N4O3 — CID 140707312
N-[[4-(hydroxycarbamoyl)phenyl]methyl]-3,5-dimethyl-4-(2,2,3,3,3-pentafluoropropyl)-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 140707312) has the molecular formula C25H26F8N4O3 and a molecular weight of 582.49 g/mol. Its IUPAC name is N-[[4-(hydroxycarbamoyl)phenyl]methyl]-3,5-dimethyl-4-(2,2,3,3,3-pentafluoropropyl)-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-[[4-(hydroxycarbamoyl)phenyl]methyl]-3,5-dimethyl-4-(2,2,3,3,3-pentafluoropropyl)-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 140707312 |
| Molecular Formula | C25H26F8N4O3 |
| Molecular Weight | 582.49 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | N-[[4-(hydroxycarbamoyl)phenyl]methyl]-3,5-dimethyl-4-(2,2,3,3,3-pentafluoropropyl)-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | CC1CN(C(=O)N(Cc2ccc(C(=O)NO)cc2)c2cccc(C(F)(F)F)c2)CC(C)N1CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H26F8N4O3/c1-15-11-35(12-16(2)37(15)14-23(26,27)25(31,32)33)22(39)36(20-5-3-4-19(10-20)24(28,29)30)13-17-6-8-18(9-7-17)21(38)34-40/h3-10,15-16,40H,11-14H2,1-2H3,(H,34,38) |
| InChIKey | RQHBKRIUUIBFCT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|