C25H23N3O5 — CID 86281473
N-[3-(1,3-benzodioxol-5-yl)phenyl]-N-[[4-(hydroxycarbamoyl)phenyl]methyl]azetidine-1-carboxamide (PubChem CID 86281473) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yl)phenyl]-N-[[4-(hydroxycarbamoyl)phenyl]methyl]azetidine-1-carboxamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-yl)phenyl]-N-[[4-(hydroxycarbamoyl)phenyl]methyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 86281473 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yl)phenyl]-N-[[4-(hydroxycarbamoyl)phenyl]methyl]azetidine-1-carboxamide |
| SMILES | O=C(NO)c1ccc(CN(C(=O)N2CCC2)c2cccc(-c3ccc4c(c3)OCO4)c2)cc1 |
| InChI | InChI=1S/C25H23N3O5/c29-24(26-31)18-7-5-17(6-8-18)15-28(25(30)27-11-2-12-27)21-4-1-3-19(13-21)20-9-10-22-23(14-20)33-16-32-22/h1,3-10,13-14,31H,2,11-12,15-16H2,(H,26,29) |
| InChIKey | FXFUHVKICFGLMB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|