C26H26N4O6S — CID 140894264
N-[4-(1,3-benzodioxol-5-yl)phenyl]-N-[[4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide (PubChem CID 140894264) has the molecular formula C26H26N4O6S and a molecular weight of 522.58 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-yl)phenyl]-N-[[4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-yl)phenyl]-N-[[4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 140894264 |
| Molecular Formula | C26H26N4O6S |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-yl)phenyl]-N-[[4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide |
| SMILES | NNC(=O)c1ccc(CN(C(=O)N2CCS(=O)(=O)CC2)c2ccc(-c3ccc4c(c3)OCO4)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O6S/c27-28-25(31)20-3-1-18(2-4-20)16-30(26(32)29-11-13-37(33,34)14-12-29)22-8-5-19(6-9-22)21-7-10-23-24(15-21)36-17-35-23/h1-10,15H,11-14,16-17,27H2,(H,28,31) |
| InChIKey | YMPMOPFEGOUULS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|