C26H25F2N5O5S — CID 140894376
N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-1,1-dioxo-N-(4-pyridin-3-ylphenyl)-1,4-thiazinane-4-carboxamide (PubChem CID 140894376) has the molecular formula C26H25F2N5O5S and a molecular weight of 557.58 g/mol. Its IUPAC name is N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-1,1-dioxo-N-(4-pyridin-3-ylphenyl)-1,4-thiazinane-4-carboxamide.
| Compound Name | N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-1,1-dioxo-N-(4-pyridin-3-ylphenyl)-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 140894376 |
| Molecular Formula | C26H25F2N5O5S |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-1,1-dioxo-N-(4-pyridin-3-ylphenyl)-1,4-thiazinane-4-carboxamide |
| SMILES | O=C(NNC(=O)C(F)F)c1ccc(CN(C(=O)N2CCS(=O)(=O)CC2)c2ccc(-c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C26H25F2N5O5S/c27-23(28)25(35)31-30-24(34)20-5-3-18(4-6-20)17-33(26(36)32-12-14-39(37,38)15-13-32)22-9-7-19(8-10-22)21-2-1-11-29-16-21/h1-11,16,23H,12-15,17H2,(H,30,34)(H,31,35) |
| InChIKey | VVRSSQNASXWYAI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|