C22H18F2N4O3 — CID 134568607
N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-phenylpyridine-4-carboxamide (PubChem CID 134568607) has the molecular formula C22H18F2N4O3 and a molecular weight of 424.41 g/mol. Its IUPAC name is N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-phenylpyridine-4-carboxamide.
| Compound Name | N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-phenylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 134568607 |
| Molecular Formula | C22H18F2N4O3 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-phenylpyridine-4-carboxamide |
| SMILES | O=C(NNC(=O)C(F)F)c1ccc(CN(C(=O)c2ccncc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18F2N4O3/c23-19(24)21(30)27-26-20(29)16-8-6-15(7-9-16)14-28(18-4-2-1-3-5-18)22(31)17-10-12-25-13-11-17/h1-13,19H,14H2,(H,26,29)(H,27,30) |
| InChIKey | HFDRAABRWBMNKY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|