C23H18F3N3O3 — CID 126544300
N-phenyl-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]benzamide (PubChem CID 126544300) has the molecular formula C23H18F3N3O3 and a molecular weight of 441.41 g/mol. Its IUPAC name is N-phenyl-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]benzamide.
| Compound Name | N-phenyl-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 126544300 |
| Molecular Formula | C23H18F3N3O3 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-phenyl-N-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]benzamide |
| SMILES | O=C(NNC(=O)C(F)(F)F)c1ccc(CN(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18F3N3O3/c24-23(25,26)22(32)28-27-20(30)17-13-11-16(12-14-17)15-29(19-9-5-2-6-10-19)21(31)18-7-3-1-4-8-18/h1-14H,15H2,(H,27,30)(H,28,32) |
| InChIKey | WCMJQDQWZBWGTM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|