C19H19F3N4O3 — CID 134584626
3-ethyl-1-phenyl-1-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]urea (PubChem CID 134584626) has the molecular formula C19H19F3N4O3 and a molecular weight of 408.38 g/mol. Its IUPAC name is 3-ethyl-1-phenyl-1-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]urea.
| Compound Name | 3-ethyl-1-phenyl-1-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 134584626 |
| Molecular Formula | C19H19F3N4O3 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-ethyl-1-phenyl-1-[[4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]urea |
| SMILES | CCNC(=O)N(Cc1ccc(C(=O)NNC(=O)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H19F3N4O3/c1-2-23-18(29)26(15-6-4-3-5-7-15)12-13-8-10-14(11-9-13)16(27)24-25-17(28)19(20,21)22/h3-11H,2,12H2,1H3,(H,23,29)(H,24,27)(H,25,28) |
| InChIKey | XEFVLRABPXUGGL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|