C19H17F4IN4O2 — CID 162598389
1-(3-fluorophenyl)-3-(iodomethyl)-1-[[4-[1-[2-(2,2,2-trifluoroacetyl)hydrazinyl]ethenyl]phenyl]methyl]urea (PubChem CID 162598389) has the molecular formula C19H17F4IN4O2 and a molecular weight of 536.27 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-(iodomethyl)-1-[[4-[1-[2-(2,2,2-trifluoroacetyl)hydrazinyl]ethenyl]phenyl]methyl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-(iodomethyl)-1-[[4-[1-[2-(2,2,2-trifluoroacetyl)hydrazinyl]ethenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 162598389 |
| Molecular Formula | C19H17F4IN4O2 |
| Molecular Weight | 536.27 g/mol |
| Exact Mass | 536.03 |
| IUPAC Name | 1-(3-fluorophenyl)-3-(iodomethyl)-1-[[4-[1-[2-(2,2,2-trifluoroacetyl)hydrazinyl]ethenyl]phenyl]methyl]urea |
| SMILES | C=C(NNC(=O)C(F)(F)F)c1ccc(CN(C(=O)NCI)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C19H17F4IN4O2/c1-12(26-27-17(29)19(21,22)23)14-7-5-13(6-8-14)10-28(18(30)25-11-24)16-4-2-3-15(20)9-16/h2-9,26H,1,10-11H2,(H,25,30)(H,27,29) |
| InChIKey | UXPWNEUGRQBGOL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.27 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|