C17H14F5N3O4S — CID 126507841
N-(3-fluorophenyl)-N-[[2-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]methanesulfonamide (PubChem CID 126507841) has the molecular formula C17H14F5N3O4S and a molecular weight of 451.37 g/mol. Its IUPAC name is N-(3-fluorophenyl)-N-[[2-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]methanesulfonamide.
| Compound Name | N-(3-fluorophenyl)-N-[[2-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 126507841 |
| Molecular Formula | C17H14F5N3O4S |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | N-(3-fluorophenyl)-N-[[2-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(C(=O)NNC(=O)C(F)(F)F)cc1F)c1cccc(F)c1 |
| InChI | InChI=1S/C17H14F5N3O4S/c1-30(28,29)25(13-4-2-3-12(18)8-13)9-11-6-5-10(7-14(11)19)15(26)23-24-16(27)17(20,21)22/h2-8H,9H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | SJFWYXFWRVLCPE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|