C17H16F3N3O4S — CID 126507038
N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]-2-fluorophenyl]methyl]-N-phenylmethanesulfonamide (PubChem CID 126507038) has the molecular formula C17H16F3N3O4S and a molecular weight of 415.39 g/mol. Its IUPAC name is N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]-2-fluorophenyl]methyl]-N-phenylmethanesulfonamide.
| Compound Name | N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]-2-fluorophenyl]methyl]-N-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 126507038 |
| Molecular Formula | C17H16F3N3O4S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]-2-fluorophenyl]methyl]-N-phenylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(C(=O)NNC(=O)C(F)F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C17H16F3N3O4S/c1-28(26,27)23(13-5-3-2-4-6-13)10-12-8-7-11(9-14(12)18)16(24)21-22-17(25)15(19)20/h2-9,15H,10H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | YRERRJUAJINJHG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|