C16H15BFNO4S — CID 145239090
CID 145239090 (PubChem CID 145239090) has the molecular formula C16H15BFNO4S and a molecular weight of 347.18 g/mol.
| Compound Name | CID 145239090 |
|---|---|
| PubChem CID | 145239090 |
| Molecular Formula | C16H15BFNO4S |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N(Cc2ccc(C(=O)OC)cc2F)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H15BFNO4S/c1-23-16(20)11-3-4-12(15(18)9-11)10-19(24(2,21)22)14-7-5-13(17)6-8-14/h3-9H,10H2,1-2H3 |
| InChIKey | UBGMZDPLOYZGNM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|